C25H31F3N4O5 — CID 170691957
(2R,3R,4S,5R,6R)-6-[(3-cyclohexyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol (PubChem CID 170691957) has the molecular formula C25H31F3N4O5 and a molecular weight of 524.54 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-6-[(3-cyclohexyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6R)-6-[(3-cyclohexyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
|---|---|
| PubChem CID | 170691957 |
| Molecular Formula | C25H31F3N4O5 |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | (2R,3R,4S,5R,6R)-6-[(3-cyclohexyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1CC1CC(C2CCCCC2)=NO1 |
| InChI | InChI=1S/C25H31F3N4O5/c1-35-25-20(10-15-9-18(30-37-15)13-5-3-2-4-6-13)36-21(12-33)24(34)23(25)32-11-19(29-31-32)14-7-16(26)22(28)17(27)8-14/h7-8,11,13,15,20-21,23-25,33-34H,2-6,9-10,12H2,1H3/t15?,20-,21-,23+,24+,25+/m1/s1 |
| InChIKey | JHEPCDJCTVSHHX-LMACAYBLSA-N |
| XLogP | 3.15 |
| TPSA | 111.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|