C21H21F3N6O5 — CID 170691878
(2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-[[3-(1H-pyrazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 170691878) has the molecular formula C21H21F3N6O5 and a molecular weight of 494.43 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-[[3-(1H-pyrazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-[[3-(1H-pyrazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 170691878 |
| Molecular Formula | C21H21F3N6O5 |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | (2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-[[3-(1H-pyrazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | OC[C@H]1O[C@H](CC2CC(c3cn[nH]c3)=NO2)[C@H](O)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C21H21F3N6O5/c22-12-1-9(2-13(23)18(12)24)15-7-30(29-27-15)19-20(32)16(34-17(8-31)21(19)33)4-11-3-14(28-35-11)10-5-25-26-6-10/h1-2,5-7,11,16-17,19-21,31-33H,3-4,8H2,(H,25,26)/t11?,16-,17-,19-,20+,21+/m1/s1 |
| InChIKey | CCIXRZWWFDJNHD-MNMREWHJSA-N |
| XLogP | 0.69 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|