C25H25F3N4O6 — CID 170691939
(2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-[[(5S)-3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 170691939) has the molecular formula C25H25F3N4O6 and a molecular weight of 534.49 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-[[(5S)-3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-[[(5S)-3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 170691939 |
| Molecular Formula | C25H25F3N4O6 |
| Molecular Weight | 534.49 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | (2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-[[(5S)-3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | COc1ccc(C2=NO[C@H](C[C@H]3O[C@H](CO)[C@H](O)[C@H](n4cc(-c5cc(F)c(F)c(F)c5)nn4)[C@H]3O)C2)cc1 |
| InChI | InChI=1S/C25H25F3N4O6/c1-36-14-4-2-12(3-5-14)18-8-15(38-30-18)9-20-24(34)23(25(35)21(11-33)37-20)32-10-19(29-31-32)13-6-16(26)22(28)17(27)7-13/h2-7,10,15,20-21,23-25,33-35H,8-9,11H2,1H3/t15-,20+,21+,23+,24-,25-/m0/s1 |
| InChIKey | BUOSJHLBNQUHEC-SSGHDWBNSA-N |
| XLogP | 1.98 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|