C24H30F3N5O5 — CID 170691968
(2R,3R,4S,5R,6R)-2-(hydroxymethyl)-5-methoxy-6-[[(5R)-3-piperidin-4-yl-4,5-dihydro-1,2-oxazol-5-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol (PubChem CID 170691968) has the molecular formula C24H30F3N5O5 and a molecular weight of 525.53 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-5-methoxy-6-[[(5R)-3-piperidin-4-yl-4,5-dihydro-1,2-oxazol-5-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-5-methoxy-6-[[(5R)-3-piperidin-4-yl-4,5-dihydro-1,2-oxazol-5-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
|---|---|
| PubChem CID | 170691968 |
| Molecular Formula | C24H30F3N5O5 |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-5-methoxy-6-[[(5R)-3-piperidin-4-yl-4,5-dihydro-1,2-oxazol-5-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1C[C@H]1CC(C2CCNCC2)=NO1 |
| InChI | InChI=1S/C24H30F3N5O5/c1-35-24-19(9-14-8-17(30-37-14)12-2-4-28-5-3-12)36-20(11-33)23(34)22(24)32-10-18(29-31-32)13-6-15(25)21(27)16(26)7-13/h6-7,10,12,14,19-20,22-24,28,33-34H,2-5,8-9,11H2,1H3/t14-,19-,20-,22+,23+,24+/m1/s1 |
| InChIKey | OKLDRBPNGVGMRI-AMIPALGQSA-N |
| XLogP | 1.57 |
| TPSA | 123.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|