C30H34F3N7O4 — CID 176862321
(2R,3R,4S,5R,6R)-2-(hydroxymethyl)-5-methoxy-6-[[4-[1-(2-methylphenyl)piperidin-4-yl]triazol-1-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol (PubChem CID 176862321) has the molecular formula C30H34F3N7O4 and a molecular weight of 613.64 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-5-methoxy-6-[[4-[1-(2-methylphenyl)piperidin-4-yl]triazol-1-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-5-methoxy-6-[[4-[1-(2-methylphenyl)piperidin-4-yl]triazol-1-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
|---|---|
| PubChem CID | 176862321 |
| Molecular Formula | C30H34F3N7O4 |
| Molecular Weight | 613.64 g/mol |
| Exact Mass | 613.26 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-5-methoxy-6-[[4-[1-(2-methylphenyl)piperidin-4-yl]triazol-1-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1Cn1cc(C2CCN(c3ccccc3C)CC2)nn1 |
| InChI | InChI=1S/C30H34F3N7O4/c1-17-5-3-4-6-24(17)38-9-7-18(8-10-38)22-13-39(36-34-22)15-25-30(43-2)28(29(42)26(16-41)44-25)40-14-23(35-37-40)19-11-20(31)27(33)21(32)12-19/h3-6,11-14,18,25-26,28-30,41-42H,7-10,15-16H2,1-2H3/t25-,26-,28+,29+,30+/m1/s1 |
| InChIKey | LVSIATQHLXHVQK-NKPFXSPFSA-N |
| XLogP | 3.02 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.64 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|