C25H24Cl2F2N6O4 — CID 156682904
(2R,3R,4S,5R,6S)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-6-[4-(5-chloro-2-methylphenyl)-5-methyl-1,2,4-triazol-3-yl]-2-(hydroxymethyl)-5-methoxyoxan-3-ol (PubChem CID 156682904) has the molecular formula C25H24Cl2F2N6O4 and a molecular weight of 581.41 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-6-[4-(5-chloro-2-methylphenyl)-5-methyl-1,2,4-triazol-3-yl]-2-(hydroxymethyl)-5-methoxyoxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6S)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-6-[4-(5-chloro-2-methylphenyl)-5-methyl-1,2,4-triazol-3-yl]-2-(hydroxymethyl)-5-methoxyoxan-3-ol |
|---|---|
| PubChem CID | 156682904 |
| Molecular Formula | C25H24Cl2F2N6O4 |
| Molecular Weight | 581.41 g/mol |
| Exact Mass | 580.12 |
| IUPAC Name | (2R,3R,4S,5R,6S)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-6-[4-(5-chloro-2-methylphenyl)-5-methyl-1,2,4-triazol-3-yl]-2-(hydroxymethyl)-5-methoxyoxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3cc(F)c(Cl)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@H]1c1nnc(C)n1-c1cc(Cl)ccc1C |
| InChI | InChI=1S/C25H24Cl2F2N6O4/c1-11-4-5-14(26)8-18(11)35-12(2)30-32-25(35)24-23(38-3)21(22(37)19(10-36)39-24)34-9-17(31-33-34)13-6-15(28)20(27)16(29)7-13/h4-9,19,21-24,36-37H,10H2,1-3H3/t19-,21+,22+,23-,24-/m1/s1 |
| InChIKey | RYOULNCIUWBBJX-HYPCABPSSA-N |
| XLogP | 3.78 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|