C27H28Cl2F2N6O4 — CID 138517160
(2S,3R,4R,5R,6R)-2-[2-(2-tert-butyl-5-chlorophenyl)-5-methyl-1,2,4-triazol-3-yl]-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-6-(hydroxymethyl)oxane-3,5-diol (PubChem CID 138517160) has the molecular formula C27H28Cl2F2N6O4 and a molecular weight of 609.46 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2-[2-(2-tert-butyl-5-chlorophenyl)-5-methyl-1,2,4-triazol-3-yl]-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-6-(hydroxymethyl)oxane-3,5-diol.
| Compound Name | (2S,3R,4R,5R,6R)-2-[2-(2-tert-butyl-5-chlorophenyl)-5-methyl-1,2,4-triazol-3-yl]-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-6-(hydroxymethyl)oxane-3,5-diol |
|---|---|
| PubChem CID | 138517160 |
| Molecular Formula | C27H28Cl2F2N6O4 |
| Molecular Weight | 609.46 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2-[2-(2-tert-butyl-5-chlorophenyl)-5-methyl-1,2,4-triazol-3-yl]-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-6-(hydroxymethyl)oxane-3,5-diol |
| SMILES | Cc1nc([C@@H]2O[C@H](CO)[C@H](O)[C@H](n3cc(-c4cc(F)c(Cl)c(F)c4)nn3)[C@H]2O)n(-c2cc(Cl)ccc2C(C)(C)C)n1 |
| InChI | InChI=1S/C27H28Cl2F2N6O4/c1-12-32-26(37(34-12)19-9-14(28)5-6-15(19)27(2,3)4)25-24(40)22(23(39)20(11-38)41-25)36-10-18(33-35-36)13-7-16(30)21(29)17(31)8-13/h5-10,20,22-25,38-40H,11H2,1-4H3/t20-,22+,23+,24-,25-/m1/s1 |
| InChIKey | UTCNRYNYOIVAAK-HSQNVRHTSA-N |
| XLogP | 4.11 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|