C20H21ClF3N5O4 — CID 175500970
(2S,3R,4R,5R,6R)-2-[2-[5-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-(3-methylpyrazol-1-yl)oxane-3,5-diol (PubChem CID 175500970) has the molecular formula C20H21ClF3N5O4 and a molecular weight of 487.87 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2-[2-[5-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-(3-methylpyrazol-1-yl)oxane-3,5-diol.
| Compound Name | (2S,3R,4R,5R,6R)-2-[2-[5-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-(3-methylpyrazol-1-yl)oxane-3,5-diol |
|---|---|
| PubChem CID | 175500970 |
| Molecular Formula | C20H21ClF3N5O4 |
| Molecular Weight | 487.87 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2-[2-[5-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-(3-methylpyrazol-1-yl)oxane-3,5-diol |
| SMILES | Cc1ccn([C@H]2[C@@H](O)[C@@H](CO)O[C@@H](c3nc(C)nn3-c3cc(Cl)ccc3C(F)(F)F)[C@@H]2O)n1 |
| InChI | InChI=1S/C20H21ClF3N5O4/c1-9-5-6-28(26-9)15-16(31)14(8-30)33-18(17(15)32)19-25-10(2)27-29(19)13-7-11(21)3-4-12(13)20(22,23)24/h3-7,14-18,30-32H,8H2,1-2H3/t14-,15+,16+,17-,18-/m1/s1 |
| InChIKey | RRFFNLTYOFQQNP-DISONHOPSA-N |
| XLogP | 2.15 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.87 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |