C22H21ClF3N7O4S — CID 163361099
(2S,3R,4R,5R,6R)-2-[4-[5-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(4-methyl-1,3-thiazol-2-yl)triazol-1-yl]oxane-3,5-diol (PubChem CID 163361099) has the molecular formula C22H21ClF3N7O4S and a molecular weight of 571.97 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2-[4-[5-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(4-methyl-1,3-thiazol-2-yl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2S,3R,4R,5R,6R)-2-[4-[5-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(4-methyl-1,3-thiazol-2-yl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 163361099 |
| Molecular Formula | C22H21ClF3N7O4S |
| Molecular Weight | 571.97 g/mol |
| Exact Mass | 571.10 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2-[4-[5-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(4-methyl-1,3-thiazol-2-yl)triazol-1-yl]oxane-3,5-diol |
| SMILES | Cc1csc(-c2cn([C@H]3[C@@H](O)[C@@H](CO)O[C@@H](c4nnc(C)n4-c4cc(Cl)ccc4C(F)(F)F)[C@@H]3O)nn2)n1 |
| InChI | InChI=1S/C22H21ClF3N7O4S/c1-9-8-38-21(27-9)13-6-32(31-29-13)16-17(35)15(7-34)37-19(18(16)36)20-30-28-10(2)33(20)14-5-11(23)3-4-12(14)22(24,25)26/h3-6,8,15-19,34-36H,7H2,1-2H3/t15-,16+,17+,18-,19-/m1/s1 |
| InChIKey | FLAVFWRGINKMTD-ICBNADEASA-N |
| XLogP | 2.67 |
| TPSA | 144.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.97 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |