C20H19Cl2N7O4S — CID 164848597
(2S,4R,5R)-2-[4-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(4-methyl-1,3-thiazol-2-yl)triazol-1-yl]oxane-3,5-diol (PubChem CID 164848597) has the molecular formula C20H19Cl2N7O4S and a molecular weight of 524.39 g/mol. Its IUPAC name is (2S,4R,5R)-2-[4-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(4-methyl-1,3-thiazol-2-yl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2S,4R,5R)-2-[4-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(4-methyl-1,3-thiazol-2-yl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 164848597 |
| Molecular Formula | C20H19Cl2N7O4S |
| Molecular Weight | 524.39 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | (2S,4R,5R)-2-[4-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(4-methyl-1,3-thiazol-2-yl)triazol-1-yl]oxane-3,5-diol |
| SMILES | Cc1csc(-c2cn([C@@H]3C(O)[C@H](c4nncn4-c4cc(Cl)ccc4Cl)OC(CO)[C@@H]3O)nn2)n1 |
| InChI | InChI=1S/C20H19Cl2N7O4S/c1-9-7-34-20(24-9)12-5-29(27-25-12)15-16(31)14(6-30)33-18(17(15)32)19-26-23-8-28(19)13-4-10(21)2-3-11(13)22/h2-5,7-8,14-18,30-32H,6H2,1H3/t14?,15-,16-,17?,18+/m0/s1 |
| InChIKey | XSWHXXFFZDOJKW-HBWZYELFSA-N |
| XLogP | 1.99 |
| TPSA | 144.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |