C22H17Cl2F3N6O4 — CID 138516704
(2S,3R,4R,5R,6R)-2-[2-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 138516704) has the molecular formula C22H17Cl2F3N6O4 and a molecular weight of 557.32 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2-[2-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2S,3R,4R,5R,6R)-2-[2-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 138516704 |
| Molecular Formula | C22H17Cl2F3N6O4 |
| Molecular Weight | 557.32 g/mol |
| Exact Mass | 556.06 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2-[2-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | OC[C@H]1O[C@@H](c2ncnn2-c2cc(Cl)ccc2Cl)[C@H](O)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C22H17Cl2F3N6O4/c23-10-1-2-11(24)15(5-10)33-22(28-8-29-33)21-20(36)18(19(35)16(7-34)37-21)32-6-14(30-31-32)9-3-12(25)17(27)13(26)4-9/h1-6,8,16,18-21,34-36H,7H2/t16-,18+,19+,20-,21-/m1/s1 |
| InChIKey | NDWVMRYMUOYREG-OBJCFNGXSA-N |
| XLogP | 2.65 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|