C18H18F3N5O4 — CID 138505707
2-(hydroxymethyl)-6-(2-methylpyrazol-3-yl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 138505707) has the molecular formula C18H18F3N5O4 and a molecular weight of 425.37 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-(2-methylpyrazol-3-yl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | 2-(hydroxymethyl)-6-(2-methylpyrazol-3-yl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 138505707 |
| Molecular Formula | C18H18F3N5O4 |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 2-(hydroxymethyl)-6-(2-methylpyrazol-3-yl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | Cn1nccc1C1OC(CO)C(O)C(n2cc(-c3cc(F)c(F)c(F)c3)nn2)C1O |
| InChI | InChI=1S/C18H18F3N5O4/c1-25-12(2-3-22-25)18-17(29)15(16(28)13(7-27)30-18)26-6-11(23-24-26)8-4-9(19)14(21)10(20)5-8/h2-6,13,15-18,27-29H,7H2,1H3 |
| InChIKey | TXGXIBKSQHDNAX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|