C22H18ClF3N6O4 — CID 138505830
(2S,3R,4R,5R,6R)-2-[5-(3-chlorophenyl)-2H-triazol-4-yl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 138505830) has the molecular formula C22H18ClF3N6O4 and a molecular weight of 522.87 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2-[5-(3-chlorophenyl)-2H-triazol-4-yl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2S,3R,4R,5R,6R)-2-[5-(3-chlorophenyl)-2H-triazol-4-yl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 138505830 |
| Molecular Formula | C22H18ClF3N6O4 |
| Molecular Weight | 522.87 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2-[5-(3-chlorophenyl)-2H-triazol-4-yl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | OC[C@H]1O[C@@H](c2n[nH]nc2-c2cccc(Cl)c2)[C@H](O)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C22H18ClF3N6O4/c23-11-3-1-2-9(4-11)17-18(29-30-28-17)22-21(35)19(20(34)15(8-33)36-22)32-7-14(27-31-32)10-5-12(24)16(26)13(25)6-10/h1-7,15,19-22,33-35H,8H2,(H,28,29,30)/t15-,19+,20+,21-,22+/m1/s1 |
| InChIKey | QTDLRTZUDQKGFU-FDAZALDWSA-N |
| XLogP | 2.20 |
| TPSA | 142.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.87 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|