C22H18F4N6O4 — CID 142552487
(2S,3R,5R,6R)-2-[4-(2-fluorophenyl)-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 142552487) has the molecular formula C22H18F4N6O4 and a molecular weight of 506.42 g/mol. Its IUPAC name is (2S,3R,5R,6R)-2-[4-(2-fluorophenyl)-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2S,3R,5R,6R)-2-[4-(2-fluorophenyl)-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 142552487 |
| Molecular Formula | C22H18F4N6O4 |
| Molecular Weight | 506.42 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | (2S,3R,5R,6R)-2-[4-(2-fluorophenyl)-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | OC[C@H]1O[C@@H](c2nncn2-c2ccccc2F)[C@H](O)C(n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C22H18F4N6O4/c23-11-3-1-2-4-15(11)31-9-27-29-22(31)21-20(35)18(19(34)16(8-33)36-21)32-7-14(28-30-32)10-5-12(24)17(26)13(25)6-10/h1-7,9,16,18-21,33-35H,8H2/t16-,18?,19+,20-,21-/m1/s1 |
| InChIKey | BPEQOLPVDUAKKN-KQUNXGBGSA-N |
| XLogP | 1.48 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|