C25H21F3N8O4 — CID 138517042
(2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-[4-(4-imidazol-1-ylphenyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 138517042) has the molecular formula C25H21F3N8O4 and a molecular weight of 554.49 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-[4-(4-imidazol-1-ylphenyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-[4-(4-imidazol-1-ylphenyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 138517042 |
| Molecular Formula | C25H21F3N8O4 |
| Molecular Weight | 554.49 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-[4-(4-imidazol-1-ylphenyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | OC[C@H]1O[C@@H](c2nncn2-c2ccc(-n3ccnc3)cc2)[C@H](O)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C25H21F3N8O4/c26-16-7-13(8-17(27)20(16)28)18-9-36(33-31-18)21-22(38)19(10-37)40-24(23(21)39)25-32-30-12-35(25)15-3-1-14(2-4-15)34-6-5-29-11-34/h1-9,11-12,19,21-24,37-39H,10H2/t19-,21+,22+,23-,24-/m1/s1 |
| InChIKey | BTIZPBRKVMPUOO-HYPCABPSSA-N |
| XLogP | 1.52 |
| TPSA | 149.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.49 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|