C25H20F3N7O4 — CID 138516975
(2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-(4-quinolin-3-yl-1,2,4-triazol-3-yl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 138516975) has the molecular formula C25H20F3N7O4 and a molecular weight of 539.47 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-(4-quinolin-3-yl-1,2,4-triazol-3-yl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-(4-quinolin-3-yl-1,2,4-triazol-3-yl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 138516975 |
| Molecular Formula | C25H20F3N7O4 |
| Molecular Weight | 539.47 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-(4-quinolin-3-yl-1,2,4-triazol-3-yl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | OC[C@H]1O[C@@H](c2nncn2-c2cnc3ccccc3c2)[C@H](O)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C25H20F3N7O4/c26-15-6-13(7-16(27)20(15)28)18-9-35(33-31-18)21-22(37)19(10-36)39-24(23(21)38)25-32-30-11-34(25)14-5-12-3-1-2-4-17(12)29-8-14/h1-9,11,19,21-24,36-38H,10H2/t19-,21+,22+,23-,24-/m1/s1 |
| InChIKey | HOJODZQVFSMJTN-HYPCABPSSA-N |
| XLogP | 1.89 |
| TPSA | 144.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|