C21H19F3N6O4S — CID 138516520
(2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-[4-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 138516520) has the molecular formula C21H19F3N6O4S and a molecular weight of 508.48 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-[4-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-[4-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 138516520 |
| Molecular Formula | C21H19F3N6O4S |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-[4-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | OC[C@H]1O[C@@H](c2nncn2Cc2cccs2)[C@H](O)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C21H19F3N6O4S/c22-12-4-10(5-13(23)16(12)24)14-7-30(28-26-14)17-18(32)15(8-31)34-20(19(17)33)21-27-25-9-29(21)6-11-2-1-3-35-11/h1-5,7,9,15,17-20,31-33H,6,8H2/t15-,17+,18+,19-,20-/m1/s1 |
| InChIKey | PMBIWIAXXIHNCS-DABHTEOTSA-N |
| XLogP | 1.46 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|