C21H19F3N6O3S — CID 142552503
2-(hydroxymethyl)-6-[4-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol (PubChem CID 142552503) has the molecular formula C21H19F3N6O3S and a molecular weight of 492.48 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-[4-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol.
| Compound Name | 2-(hydroxymethyl)-6-[4-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
|---|---|
| PubChem CID | 142552503 |
| Molecular Formula | C21H19F3N6O3S |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 2-(hydroxymethyl)-6-[4-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
| SMILES | OCC1OC(c2nncn2Cc2cccs2)CC(n2cc(-c3cc(F)c(F)c(F)c3)nn2)C1O |
| InChI | InChI=1S/C21H19F3N6O3S/c22-13-4-11(5-14(23)19(13)24)15-8-30(28-26-15)16-6-17(33-18(9-31)20(16)32)21-27-25-10-29(21)7-12-2-1-3-34-12/h1-5,8,10,16-18,20,31-32H,6-7,9H2 |
| InChIKey | YECNJTYQTPLPMB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|