C23H21F3N6O4 — CID 142552436
2-(hydroxymethyl)-6-[4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol (PubChem CID 142552436) has the molecular formula C23H21F3N6O4 and a molecular weight of 502.45 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-[4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol.
| Compound Name | 2-(hydroxymethyl)-6-[4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
|---|---|
| PubChem CID | 142552436 |
| Molecular Formula | C23H21F3N6O4 |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 2-(hydroxymethyl)-6-[4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
| SMILES | COc1ccccc1-n1cnnc1C1CC(n2cc(-c3cc(F)c(F)c(F)c3)nn2)C(O)C(CO)O1 |
| InChI | InChI=1S/C23H21F3N6O4/c1-35-18-5-3-2-4-16(18)31-11-27-29-23(31)19-8-17(22(34)20(10-33)36-19)32-9-15(28-30-32)12-6-13(24)21(26)14(25)7-12/h2-7,9,11,17,19-20,22,33-34H,8,10H2,1H3 |
| InChIKey | YDDXOKDSZHAUQT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|