C24H21ClF3N5O3 — CID 138517130
6-[4-(3-chlorophenyl)-1-methylpyrazol-5-yl]-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol (PubChem CID 138517130) has the molecular formula C24H21ClF3N5O3 and a molecular weight of 519.91 g/mol. Its IUPAC name is 6-[4-(3-chlorophenyl)-1-methylpyrazol-5-yl]-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol.
| Compound Name | 6-[4-(3-chlorophenyl)-1-methylpyrazol-5-yl]-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
|---|---|
| PubChem CID | 138517130 |
| Molecular Formula | C24H21ClF3N5O3 |
| Molecular Weight | 519.91 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | 6-[4-(3-chlorophenyl)-1-methylpyrazol-5-yl]-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
| SMILES | Cn1ncc(-c2cccc(Cl)c2)c1C1CC(n2cc(-c3cc(F)c(F)c(F)c3)nn2)C(O)C(CO)O1 |
| InChI | InChI=1S/C24H21ClF3N5O3/c1-32-23(15(9-29-32)12-3-2-4-14(25)5-12)20-8-19(24(35)21(11-34)36-20)33-10-18(30-31-33)13-6-16(26)22(28)17(27)7-13/h2-7,9-10,19-21,24,34-35H,8,11H2,1H3 |
| InChIKey | ZZWODECHPTUHCQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.91 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|