C20H17F3N8O3 — CID 142552641
2-(hydroxymethyl)-6-(4-pyrazin-2-yl-1,2,4-triazol-3-yl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol (PubChem CID 142552641) has the molecular formula C20H17F3N8O3 and a molecular weight of 474.40 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-(4-pyrazin-2-yl-1,2,4-triazol-3-yl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol.
| Compound Name | 2-(hydroxymethyl)-6-(4-pyrazin-2-yl-1,2,4-triazol-3-yl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
|---|---|
| PubChem CID | 142552641 |
| Molecular Formula | C20H17F3N8O3 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 2-(hydroxymethyl)-6-(4-pyrazin-2-yl-1,2,4-triazol-3-yl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
| SMILES | OCC1OC(c2nncn2-c2cnccn2)CC(n2cc(-c3cc(F)c(F)c(F)c3)nn2)C1O |
| InChI | InChI=1S/C20H17F3N8O3/c21-11-3-10(4-12(22)18(11)23)13-7-31(29-27-13)14-5-15(34-16(8-32)19(14)33)20-28-26-9-30(20)17-6-24-1-2-25-17/h1-4,6-7,9,14-16,19,32-33H,5,8H2 |
| InChIKey | CVDKHXOHAYQCOQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 136.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|