C22H18F4N6O3 — CID 142552321
6-[4-(4-fluorophenyl)-1,2,4-triazol-3-yl]-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol (PubChem CID 142552321) has the molecular formula C22H18F4N6O3 and a molecular weight of 490.42 g/mol. Its IUPAC name is 6-[4-(4-fluorophenyl)-1,2,4-triazol-3-yl]-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol.
| Compound Name | 6-[4-(4-fluorophenyl)-1,2,4-triazol-3-yl]-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
|---|---|
| PubChem CID | 142552321 |
| Molecular Formula | C22H18F4N6O3 |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 6-[4-(4-fluorophenyl)-1,2,4-triazol-3-yl]-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
| SMILES | OCC1OC(c2nncn2-c2ccc(F)cc2)CC(n2cc(-c3cc(F)c(F)c(F)c3)nn2)C1O |
| InChI | InChI=1S/C22H18F4N6O3/c23-12-1-3-13(4-2-12)31-10-27-29-22(31)18-7-17(21(34)19(9-33)35-18)32-8-16(28-30-32)11-5-14(24)20(26)15(25)6-11/h1-6,8,10,17-19,21,33-34H,7,9H2 |
| InChIKey | LXWUQWVGECHXPG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|