C23H19F3N6O6 — CID 142552181
(3R,5R)-2-[4-(1,3-benzodioxol-5-yl)-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 142552181) has the molecular formula C23H19F3N6O6 and a molecular weight of 532.44 g/mol. Its IUPAC name is (3R,5R)-2-[4-(1,3-benzodioxol-5-yl)-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (3R,5R)-2-[4-(1,3-benzodioxol-5-yl)-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 142552181 |
| Molecular Formula | C23H19F3N6O6 |
| Molecular Weight | 532.44 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | (3R,5R)-2-[4-(1,3-benzodioxol-5-yl)-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | OCC1OC(c2nncn2-c2ccc3c(c2)OCO3)[C@H](O)C(n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C23H19F3N6O6/c24-12-3-10(4-13(25)18(12)26)14-6-32(30-28-14)19-20(34)17(7-33)38-22(21(19)35)23-29-27-8-31(23)11-1-2-15-16(5-11)37-9-36-15/h1-6,8,17,19-22,33-35H,7,9H2/t17?,19?,20-,21+,22?/m0/s1 |
| InChIKey | WCNOFZUNEQFHMI-MIRXEQCXSA-N |
| XLogP | 1.07 |
| TPSA | 149.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|