C24H20ClF3N4O3S — CID 142552402
6-[5-(3-chlorophenyl)-2-methyl-1,3-thiazol-4-yl]-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol (PubChem CID 142552402) has the molecular formula C24H20ClF3N4O3S and a molecular weight of 536.96 g/mol. Its IUPAC name is 6-[5-(3-chlorophenyl)-2-methyl-1,3-thiazol-4-yl]-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol.
| Compound Name | 6-[5-(3-chlorophenyl)-2-methyl-1,3-thiazol-4-yl]-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
|---|---|
| PubChem CID | 142552402 |
| Molecular Formula | C24H20ClF3N4O3S |
| Molecular Weight | 536.96 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | 6-[5-(3-chlorophenyl)-2-methyl-1,3-thiazol-4-yl]-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
| SMILES | Cc1nc(C2CC(n3cc(-c4cc(F)c(F)c(F)c4)nn3)C(O)C(CO)O2)c(-c2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C24H20ClF3N4O3S/c1-11-29-22(24(36-11)12-3-2-4-14(25)5-12)19-8-18(23(34)20(10-33)35-19)32-9-17(30-31-32)13-6-15(26)21(28)16(27)7-13/h2-7,9,18-20,23,33-34H,8,10H2,1H3 |
| InChIKey | ZXUPPFORZJFMIS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.96 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|