C23H19Cl3F2N6O4 — CID 138516809
(2S,3R,4R,5R,6R)-4-[4-(4-chloro-3-fluorophenyl)triazol-1-yl]-2-[2-(2,5-dichloro-4-fluorophenyl)-5-methyl-1,2,4-triazol-3-yl]-6-(hydroxymethyl)oxane-3,5-diol (PubChem CID 138516809) has the molecular formula C23H19Cl3F2N6O4 and a molecular weight of 587.80 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-4-[4-(4-chloro-3-fluorophenyl)triazol-1-yl]-2-[2-(2,5-dichloro-4-fluorophenyl)-5-methyl-1,2,4-triazol-3-yl]-6-(hydroxymethyl)oxane-3,5-diol.
| Compound Name | (2S,3R,4R,5R,6R)-4-[4-(4-chloro-3-fluorophenyl)triazol-1-yl]-2-[2-(2,5-dichloro-4-fluorophenyl)-5-methyl-1,2,4-triazol-3-yl]-6-(hydroxymethyl)oxane-3,5-diol |
|---|---|
| PubChem CID | 138516809 |
| Molecular Formula | C23H19Cl3F2N6O4 |
| Molecular Weight | 587.80 g/mol |
| Exact Mass | 586.05 |
| IUPAC Name | (2S,3R,4R,5R,6R)-4-[4-(4-chloro-3-fluorophenyl)triazol-1-yl]-2-[2-(2,5-dichloro-4-fluorophenyl)-5-methyl-1,2,4-triazol-3-yl]-6-(hydroxymethyl)oxane-3,5-diol |
| SMILES | Cc1nc([C@@H]2O[C@H](CO)[C@H](O)[C@H](n3cc(-c4ccc(Cl)c(F)c4)nn3)[C@H]2O)n(-c2cc(Cl)c(F)cc2Cl)n1 |
| InChI | InChI=1S/C23H19Cl3F2N6O4/c1-9-29-23(34(31-9)17-6-12(25)15(28)5-13(17)26)22-21(37)19(20(36)18(8-35)38-22)33-7-16(30-32-33)10-2-3-11(24)14(27)4-10/h2-7,18-22,35-37H,8H2,1H3/t18-,19+,20+,21-,22-/m1/s1 |
| InChIKey | PVCDRVPLAKQKFB-CDJZJNNCSA-N |
| XLogP | 3.47 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.80 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|