C24H20Cl3F3N6O4 — CID 138505813
(2S,3R,4R,5R,6R)-2-[2-[5-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1,2,4-triazol-3-yl]-4-[4-(3,4-dichlorophenyl)triazol-1-yl]-6-(hydroxymethyl)oxane-3,5-diol (PubChem CID 138505813) has the molecular formula C24H20Cl3F3N6O4 and a molecular weight of 619.82 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2-[2-[5-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1,2,4-triazol-3-yl]-4-[4-(3,4-dichlorophenyl)triazol-1-yl]-6-(hydroxymethyl)oxane-3,5-diol.
| Compound Name | (2S,3R,4R,5R,6R)-2-[2-[5-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1,2,4-triazol-3-yl]-4-[4-(3,4-dichlorophenyl)triazol-1-yl]-6-(hydroxymethyl)oxane-3,5-diol |
|---|---|
| PubChem CID | 138505813 |
| Molecular Formula | C24H20Cl3F3N6O4 |
| Molecular Weight | 619.82 g/mol |
| Exact Mass | 618.06 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2-[2-[5-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1,2,4-triazol-3-yl]-4-[4-(3,4-dichlorophenyl)triazol-1-yl]-6-(hydroxymethyl)oxane-3,5-diol |
| SMILES | Cc1nc([C@@H]2O[C@H](CO)[C@H](O)[C@H](n3cc(-c4ccc(Cl)c(Cl)c4)nn3)[C@H]2O)n(-c2cc(Cl)ccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C24H20Cl3F3N6O4/c1-10-31-23(36(33-10)17-7-12(25)3-4-13(17)24(28,29)30)22-21(39)19(20(38)18(9-37)40-22)35-8-16(32-34-35)11-2-5-14(26)15(27)6-11/h2-8,18-22,37-39H,9H2,1H3/t18-,19+,20+,21-,22-/m1/s1 |
| InChIKey | UHFFSEWGKGCCJK-CDJZJNNCSA-N |
| XLogP | 4.21 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.82 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |