C20H19BrClN7O4S — CID 164848592
(2S,4R,5R)-2-[2-(2-bromo-5-chlorophenyl)-5-methyl-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(1,3-thiazol-2-yl)triazol-1-yl]oxane-3,5-diol (PubChem CID 164848592) has the molecular formula C20H19BrClN7O4S and a molecular weight of 568.84 g/mol. Its IUPAC name is (2S,4R,5R)-2-[2-(2-bromo-5-chlorophenyl)-5-methyl-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(1,3-thiazol-2-yl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2S,4R,5R)-2-[2-(2-bromo-5-chlorophenyl)-5-methyl-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(1,3-thiazol-2-yl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 164848592 |
| Molecular Formula | C20H19BrClN7O4S |
| Molecular Weight | 568.84 g/mol |
| Exact Mass | 567.01 |
| IUPAC Name | (2S,4R,5R)-2-[2-(2-bromo-5-chlorophenyl)-5-methyl-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(1,3-thiazol-2-yl)triazol-1-yl]oxane-3,5-diol |
| SMILES | Cc1nc([C@@H]2OC(CO)[C@H](O)[C@H](n3cc(-c4nccs4)nn3)C2O)n(-c2cc(Cl)ccc2Br)n1 |
| InChI | InChI=1S/C20H19BrClN7O4S/c1-9-24-19(29(26-9)13-6-10(22)2-3-11(13)21)18-17(32)15(16(31)14(8-30)33-18)28-7-12(25-27-28)20-23-4-5-34-20/h2-7,14-18,30-32H,8H2,1H3/t14?,15-,16-,17?,18+/m0/s1 |
| InChIKey | SEKHTWZGLAVIHW-HBWZYELFSA-N |
| XLogP | 2.10 |
| TPSA | 144.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.84 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |