C24H22ClF3N6O4 — CID 138516963
(2R,3R,4S,5R,6S)-6-[2-(3-chlorophenyl)-1,2,4-triazol-3-yl]-5-ethoxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol (PubChem CID 138516963) has the molecular formula C24H22ClF3N6O4 and a molecular weight of 550.93 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-6-[2-(3-chlorophenyl)-1,2,4-triazol-3-yl]-5-ethoxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6S)-6-[2-(3-chlorophenyl)-1,2,4-triazol-3-yl]-5-ethoxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
|---|---|
| PubChem CID | 138516963 |
| Molecular Formula | C24H22ClF3N6O4 |
| Molecular Weight | 550.93 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | (2R,3R,4S,5R,6S)-6-[2-(3-chlorophenyl)-1,2,4-triazol-3-yl]-5-ethoxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
| SMILES | CCO[C@@H]1[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@H]1c1ncnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H22ClF3N6O4/c1-2-37-22-20(33-9-17(31-32-33)12-6-15(26)19(28)16(27)7-12)21(36)18(10-35)38-23(22)24-29-11-30-34(24)14-5-3-4-13(25)8-14/h3-9,11,18,20-23,35-36H,2,10H2,1H3/t18-,20+,21+,22-,23-/m1/s1 |
| InChIKey | IFFCXIMJTPQMLP-YDXQKAQTSA-N |
| XLogP | 3.04 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.93 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|