C25H24F3N7O4 — CID 138516990
(2S,3R,4R,5R,6R)-2-[2-[4-(ethylideneamino)-3-methylphenyl]-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 138516990) has the molecular formula C25H24F3N7O4 and a molecular weight of 543.51 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2-[2-[4-(ethylideneamino)-3-methylphenyl]-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2S,3R,4R,5R,6R)-2-[2-[4-(ethylideneamino)-3-methylphenyl]-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 138516990 |
| Molecular Formula | C25H24F3N7O4 |
| Molecular Weight | 543.51 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2-[2-[4-(ethylideneamino)-3-methylphenyl]-1,2,4-triazol-3-yl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | C/C=N/c1ccc(-n2ncnc2[C@@H]2O[C@H](CO)[C@H](O)[C@H](n3cc(-c4cc(F)c(F)c(F)c4)nn3)[C@H]2O)cc1C |
| InChI | InChI=1S/C25H24F3N7O4/c1-3-29-17-5-4-14(6-12(17)2)35-25(30-11-31-35)24-23(38)21(22(37)19(10-36)39-24)34-9-18(32-33-34)13-7-15(26)20(28)16(27)8-13/h3-9,11,19,21-24,36-38H,10H2,1-2H3/b29-3+/t19-,21+,22+,23-,24-/m1/s1 |
| InChIKey | VJNCIVHFADLBJV-KPHFGNRZSA-N |
| XLogP | 2.37 |
| TPSA | 143.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|