C25H30ClFN4O5 — CID 170692025
(2R,3R,4S,5R,6R)-4-[4-(4-chloro-3-fluorophenyl)triazol-1-yl]-6-[(5-cyclohexyl-1,2-oxazol-3-yl)methyl]-2-(hydroxymethyl)-5-methoxyoxan-3-ol (PubChem CID 170692025) has the molecular formula C25H30ClFN4O5 and a molecular weight of 520.99 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-4-[4-(4-chloro-3-fluorophenyl)triazol-1-yl]-6-[(5-cyclohexyl-1,2-oxazol-3-yl)methyl]-2-(hydroxymethyl)-5-methoxyoxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6R)-4-[4-(4-chloro-3-fluorophenyl)triazol-1-yl]-6-[(5-cyclohexyl-1,2-oxazol-3-yl)methyl]-2-(hydroxymethyl)-5-methoxyoxan-3-ol |
|---|---|
| PubChem CID | 170692025 |
| Molecular Formula | C25H30ClFN4O5 |
| Molecular Weight | 520.99 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | (2R,3R,4S,5R,6R)-4-[4-(4-chloro-3-fluorophenyl)triazol-1-yl]-6-[(5-cyclohexyl-1,2-oxazol-3-yl)methyl]-2-(hydroxymethyl)-5-methoxyoxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3ccc(Cl)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1Cc1cc(C2CCCCC2)on1 |
| InChI | InChI=1S/C25H30ClFN4O5/c1-34-25-21(11-16-10-20(36-29-16)14-5-3-2-4-6-14)35-22(13-32)24(33)23(25)31-12-19(28-30-31)15-7-8-17(26)18(27)9-15/h7-10,12,14,21-25,32-33H,2-6,11,13H2,1H3/t21-,22-,23+,24+,25+/m1/s1 |
| InChIKey | GCQUVMMRXXWUAJ-VAFBSOEGSA-N |
| XLogP | 3.69 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.99 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |