C22H18Cl2F3N3O8S — CID 138544643
2-[(2R,3R,4S,5R,6R)-2-(3,4-dichlorophenyl)sulfonyl-5-hydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-yl]oxyacetic acid (PubChem CID 138544643) has the molecular formula C22H18Cl2F3N3O8S and a molecular weight of 612.37 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R,6R)-2-(3,4-dichlorophenyl)sulfonyl-5-hydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-yl]oxyacetic acid.
| Compound Name | 2-[(2R,3R,4S,5R,6R)-2-(3,4-dichlorophenyl)sulfonyl-5-hydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 138544643 |
| Molecular Formula | C22H18Cl2F3N3O8S |
| Molecular Weight | 612.37 g/mol |
| Exact Mass | 611.01 |
| IUPAC Name | 2-[(2R,3R,4S,5R,6R)-2-(3,4-dichlorophenyl)sulfonyl-5-hydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-yl]oxyacetic acid |
| SMILES | O=C(O)CO[C@@H]1[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H18Cl2F3N3O8S/c23-11-2-1-10(5-12(11)24)39(35,36)22-21(37-8-17(32)33)19(20(34)16(7-31)38-22)30-6-15(28-29-30)9-3-13(25)18(27)14(26)4-9/h1-6,16,19-22,31,34H,7-8H2,(H,32,33)/t16-,19+,20+,21-,22-/m1/s1 |
| InChIKey | VSMQNSXVMCAVDN-WIXLDOGYSA-N |
| XLogP | 2.23 |
| TPSA | 161.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|