C19H16ClF3N4O5S — CID 122443473
(2R,3R,4S,5R,6R)-2-[(S)-(2-chloro-3-pyridinyl)sulfinyl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 122443473) has the molecular formula C19H16ClF3N4O5S and a molecular weight of 504.87 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-[(S)-(2-chloro-3-pyridinyl)sulfinyl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2R,3R,4S,5R,6R)-2-[(S)-(2-chloro-3-pyridinyl)sulfinyl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 122443473 |
| Molecular Formula | C19H16ClF3N4O5S |
| Molecular Weight | 504.87 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-[(S)-(2-chloro-3-pyridinyl)sulfinyl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | O=[S@@](c1cccnc1Cl)[C@H]1O[C@H](CO)[C@H](O)[C@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C19H16ClF3N4O5S/c20-18-13(2-1-3-24-18)33(31)19-17(30)15(16(29)12(7-28)32-19)27-6-11(25-26-27)8-4-9(21)14(23)10(22)5-8/h1-6,12,15-17,19,28-30H,7H2/t12-,15+,16+,17-,19-,33+/m1/s1 |
| InChIKey | NTISUQLXUXAUOZ-NKKGVJCDSA-N |
| XLogP | 1.20 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.87 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|