C26H26ClF3N4O5 — CID 166457292
2-(3-chlorophenyl)-1-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1-oxa-8-azaspiro[5.5]undecan-8-yl]ethanone (PubChem CID 166457292) has the molecular formula C26H26ClF3N4O5 and a molecular weight of 566.96 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1-oxa-8-azaspiro[5.5]undecan-8-yl]ethanone.
| Compound Name | 2-(3-chlorophenyl)-1-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1-oxa-8-azaspiro[5.5]undecan-8-yl]ethanone |
|---|---|
| PubChem CID | 166457292 |
| Molecular Formula | C26H26ClF3N4O5 |
| Molecular Weight | 566.96 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | 2-(3-chlorophenyl)-1-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1-oxa-8-azaspiro[5.5]undecan-8-yl]ethanone |
| SMILES | O=C(Cc1cccc(Cl)c1)N1CCC[C@]2(C1)O[C@H](CO)[C@H](O)[C@H](n1cc(-c3cc(F)c(F)c(F)c3)nn1)[C@H]2O |
| InChI | InChI=1S/C26H26ClF3N4O5/c27-16-4-1-3-14(7-16)8-21(36)33-6-2-5-26(13-33)25(38)23(24(37)20(12-35)39-26)34-11-19(31-32-34)15-9-17(28)22(30)18(29)10-15/h1,3-4,7,9-11,20,23-25,35,37-38H,2,5-6,8,12-13H2/t20-,23+,24+,25-,26-/m1/s1 |
| InChIKey | CIBQIVXZPAIWSI-KCQKKKKCSA-N |
| XLogP | 2.27 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.96 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|