C18H21F3N3O8P — CID 166457408
[(2R,3R,4S,5R,6S)-3-hydroxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,7-dioxaspiro[5.5]undecan-5-yl] dihydrogen phosphate (PubChem CID 166457408) has the molecular formula C18H21F3N3O8P and a molecular weight of 495.35 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3-hydroxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,7-dioxaspiro[5.5]undecan-5-yl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4S,5R,6S)-3-hydroxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,7-dioxaspiro[5.5]undecan-5-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 166457408 |
| Molecular Formula | C18H21F3N3O8P |
| Molecular Weight | 495.35 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3-hydroxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,7-dioxaspiro[5.5]undecan-5-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)O[C@@H]1[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@@]12CCCCO2 |
| InChI | InChI=1S/C18H21F3N3O8P/c19-10-5-9(6-11(20)14(10)21)12-7-24(23-22-12)15-16(26)13(8-25)31-18(3-1-2-4-30-18)17(15)32-33(27,28)29/h5-7,13,15-17,25-26H,1-4,8H2,(H2,27,28,29)/t13-,15+,16+,17-,18+/m1/s1 |
| InChIKey | VOFNCOQOYGJPPB-XNJHUCFUSA-N |
| XLogP | 1.03 |
| TPSA | 156.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|