C24H24F3N3O6 — CID 166457455
(5S,7R,8R,9S,10R)-7-(hydroxymethyl)-10-[(2-hydroxyphenyl)methoxy]-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decan-8-ol (PubChem CID 166457455) has the molecular formula C24H24F3N3O6 and a molecular weight of 507.47 g/mol. Its IUPAC name is (5S,7R,8R,9S,10R)-7-(hydroxymethyl)-10-[(2-hydroxyphenyl)methoxy]-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decan-8-ol.
| Compound Name | (5S,7R,8R,9S,10R)-7-(hydroxymethyl)-10-[(2-hydroxyphenyl)methoxy]-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decan-8-ol |
|---|---|
| PubChem CID | 166457455 |
| Molecular Formula | C24H24F3N3O6 |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | (5S,7R,8R,9S,10R)-7-(hydroxymethyl)-10-[(2-hydroxyphenyl)methoxy]-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decan-8-ol |
| SMILES | OC[C@H]1O[C@@]2(CCCO2)[C@H](OCc2ccccc2O)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C24H24F3N3O6/c25-15-8-14(9-16(26)20(15)27)17-10-30(29-28-17)21-22(33)19(11-31)36-24(6-3-7-35-24)23(21)34-12-13-4-1-2-5-18(13)32/h1-2,4-5,8-10,19,21-23,31-33H,3,6-7,11-12H2/t19-,21+,22+,23-,24+/m1/s1 |
| InChIKey | WMPIOFPZNXZSLA-SKFMWMRISA-N |
| XLogP | 2.45 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|