C29H27F6N3O6 — CID 167285923
[(4aR,6S,7R,8S,8aR)-2,2-dimethyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]spiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,2'-oxane]-7-yl] 3-(trifluoromethyl)benzoate (PubChem CID 167285923) has the molecular formula C29H27F6N3O6 and a molecular weight of 627.54 g/mol. Its IUPAC name is [(4aR,6S,7R,8S,8aR)-2,2-dimethyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]spiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,2'-oxane]-7-yl] 3-(trifluoromethyl)benzoate.
| Compound Name | [(4aR,6S,7R,8S,8aR)-2,2-dimethyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]spiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,2'-oxane]-7-yl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 167285923 |
| Molecular Formula | C29H27F6N3O6 |
| Molecular Weight | 627.54 g/mol |
| Exact Mass | 627.18 |
| IUPAC Name | [(4aR,6S,7R,8S,8aR)-2,2-dimethyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]spiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,2'-oxane]-7-yl] 3-(trifluoromethyl)benzoate |
| SMILES | CC1(C)OC[C@H]2O[C@@]3(CCCCO3)[C@H](OC(=O)c3cccc(C(F)(F)F)c3)[C@@H](n3cc(-c4cc(F)c(F)c(F)c4)nn3)[C@H]2O1 |
| InChI | InChI=1S/C29H27F6N3O6/c1-27(2)41-14-21-24(44-27)23(38-13-20(36-37-38)16-11-18(30)22(32)19(31)12-16)25(28(43-21)8-3-4-9-40-28)42-26(39)15-6-5-7-17(10-15)29(33,34)35/h5-7,10-13,21,23-25H,3-4,8-9,14H2,1-2H3/t21-,23+,24+,25-,28+/m1/s1 |
| InChIKey | GBOGBOAKVBXTCW-WCKANXHBSA-N |
| XLogP | 5.59 |
| TPSA | 93.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|