C22H24F3N3O5 — CID 156643735
[(4aR,6R,7R,8S,8aR)-2,2-dimethyl-6-prop-2-enyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate (PubChem CID 156643735) has the molecular formula C22H24F3N3O5 and a molecular weight of 467.44 g/mol. Its IUPAC name is [(4aR,6R,7R,8S,8aR)-2,2-dimethyl-6-prop-2-enyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate.
| Compound Name | [(4aR,6R,7R,8S,8aR)-2,2-dimethyl-6-prop-2-enyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate |
|---|---|
| PubChem CID | 156643735 |
| Molecular Formula | C22H24F3N3O5 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | [(4aR,6R,7R,8S,8aR)-2,2-dimethyl-6-prop-2-enyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate |
| SMILES | C=CC[C@H]1O[C@@H]2COC(C)(C)O[C@@H]2[C@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H24F3N3O5/c1-5-6-16-20(31-11(2)29)19(21-17(32-16)10-30-22(3,4)33-21)28-9-15(26-27-28)12-7-13(23)18(25)14(24)8-12/h5,7-9,16-17,19-21H,1,6,10H2,2-4H3/t16-,17-,19-,20+,21+/m1/s1 |
| InChIKey | WJDFIXIOTKXZFZ-LPOYBJAFSA-N |
| XLogP | 3.33 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|