C24H28F3N3O7 — CID 166457208
methyl (2R)-2-[(4aR,6S,7R,8S,8aR)-2,2-dimethyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]spiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,2'-oxolane]-7-yl]oxypropanoate (PubChem CID 166457208) has the molecular formula C24H28F3N3O7 and a molecular weight of 527.50 g/mol. Its IUPAC name is methyl (2R)-2-[(4aR,6S,7R,8S,8aR)-2,2-dimethyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]spiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,2'-oxolane]-7-yl]oxypropanoate.
| Compound Name | methyl (2R)-2-[(4aR,6S,7R,8S,8aR)-2,2-dimethyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]spiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,2'-oxolane]-7-yl]oxypropanoate |
|---|---|
| PubChem CID | 166457208 |
| Molecular Formula | C24H28F3N3O7 |
| Molecular Weight | 527.50 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | methyl (2R)-2-[(4aR,6S,7R,8S,8aR)-2,2-dimethyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]spiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,2'-oxolane]-7-yl]oxypropanoate |
| SMILES | COC(=O)[C@@H](C)O[C@@H]1[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]2OC(C)(C)OC[C@H]2O[C@@]12CCCO2 |
| InChI | InChI=1S/C24H28F3N3O7/c1-12(22(31)32-4)35-21-19(30-10-16(28-29-30)13-8-14(25)18(27)15(26)9-13)20-17(11-34-23(2,3)37-20)36-24(21)6-5-7-33-24/h8-10,12,17,19-21H,5-7,11H2,1-4H3/t12-,17-,19+,20+,21-,24+/m1/s1 |
| InChIKey | OGWDKDJYAVIZBK-WJQZWEFISA-N |
| XLogP | 2.91 |
| TPSA | 103.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|