C20H22F3N3O4 — CID 175838195
1-[(4aR,6S,7R,8R,8aR)-7-deuterio-2,2-dimethylspiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,2'-oxolane]-8-yl]-4-(3,4,5-trifluorophenyl)triazole (PubChem CID 175838195) has the molecular formula C20H22F3N3O4 and a molecular weight of 426.41 g/mol. Its IUPAC name is 1-[(4aR,6S,7R,8R,8aR)-7-deuterio-2,2-dimethylspiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,2'-oxolane]-8-yl]-4-(3,4,5-trifluorophenyl)triazole.
| Compound Name | 1-[(4aR,6S,7R,8R,8aR)-7-deuterio-2,2-dimethylspiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,2'-oxolane]-8-yl]-4-(3,4,5-trifluorophenyl)triazole |
|---|---|
| PubChem CID | 175838195 |
| Molecular Formula | C20H22F3N3O4 |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 1-[(4aR,6S,7R,8R,8aR)-7-deuterio-2,2-dimethylspiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,2'-oxolane]-8-yl]-4-(3,4,5-trifluorophenyl)triazole |
| SMILES | [2H][C@@H]1[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]2OC(C)(C)OC[C@H]2O[C@@]12CCCO2 |
| InChI | InChI=1S/C20H22F3N3O4/c1-19(2)28-10-16-18(30-19)15(8-20(29-16)4-3-5-27-20)26-9-14(24-25-26)11-6-12(21)17(23)13(22)7-11/h6-7,9,15-16,18H,3-5,8,10H2,1-2H3/t15-,16-,18-,20+/m1/s1/i8D/t8-,15-,16-,18-,20+ |
| InChIKey | TWQUKTZZCQGLIL-BFSUMBFGSA-N |
| XLogP | 3.35 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|