C20H26F3N3O5 — CID 167286000
(4aR,6S,7R,8R,8aR)-8-[amino-[(Z)-2-amino-2-(3,4,5-trifluorophenyl)ethenyl]amino]-2,2-dimethylspiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,2'-oxolane]-7-ol (PubChem CID 167286000) has the molecular formula C20H26F3N3O5 and a molecular weight of 445.44 g/mol. Its IUPAC name is (4aR,6S,7R,8R,8aR)-8-[amino-[(Z)-2-amino-2-(3,4,5-trifluorophenyl)ethenyl]amino]-2,2-dimethylspiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,2'-oxolane]-7-ol.
| Compound Name | (4aR,6S,7R,8R,8aR)-8-[amino-[(Z)-2-amino-2-(3,4,5-trifluorophenyl)ethenyl]amino]-2,2-dimethylspiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,2'-oxolane]-7-ol |
|---|---|
| PubChem CID | 167286000 |
| Molecular Formula | C20H26F3N3O5 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | (4aR,6S,7R,8R,8aR)-8-[amino-[(Z)-2-amino-2-(3,4,5-trifluorophenyl)ethenyl]amino]-2,2-dimethylspiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,2'-oxolane]-7-ol |
| SMILES | CC1(C)OC[C@H]2O[C@@]3(CCCO3)[C@H](O)[C@@H](N(N)/C=C(\N)c3cc(F)c(F)c(F)c3)[C@H]2O1 |
| InChI | InChI=1S/C20H26F3N3O5/c1-19(2)29-9-14-17(31-19)16(18(27)20(30-14)4-3-5-28-20)26(25)8-13(24)10-6-11(21)15(23)12(22)7-10/h6-8,14,16-18,27H,3-5,9,24-25H2,1-2H3/b13-8-/t14-,16+,17+,18-,20+/m1/s1 |
| InChIKey | PUUVGMMHQATUDQ-SWTSQIEHSA-N |
| XLogP | 1.32 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|