C13H22O6 — CID 132509065
(4aR,5'R,7R,8R,8aS)-2,2,5'-trimethylspiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,2'-oxolane]-7,8-diol (PubChem CID 132509065) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is (4aR,5'R,7R,8R,8aS)-2,2,5'-trimethylspiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,2'-oxolane]-7,8-diol.
| Compound Name | (4aR,5'R,7R,8R,8aS)-2,2,5'-trimethylspiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,2'-oxolane]-7,8-diol |
|---|---|
| PubChem CID | 132509065 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (4aR,5'R,7R,8R,8aS)-2,2,5'-trimethylspiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,2'-oxolane]-7,8-diol |
| SMILES | C[C@@H]1CCC2(O1)O[C@@H]1COC(C)(C)O[C@H]1[C@H](O)[C@H]2O |
| InChI | InChI=1S/C13H22O6/c1-7-4-5-13(17-7)11(15)9(14)10-8(18-13)6-16-12(2,3)19-10/h7-11,14-15H,4-6H2,1-3H3/t7-,8-,9+,10-,11-,13?/m1/s1 |
| InChIKey | QTRUXXSYPIQCCN-PCGQUTTJSA-N |
| XLogP | 0.15 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |