C8H14O4 — CID 102332171
(4aR,7S,7aS)-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol (PubChem CID 102332171) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is (4aR,7S,7aS)-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (4aR,7S,7aS)-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 102332171 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (4aR,7S,7aS)-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol |
| SMILES | CC1(C)OC[C@H]2OC[C@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C8H14O4/c1-8(2)11-4-6-7(12-8)5(9)3-10-6/h5-7,9H,3-4H2,1-2H3/t5-,6+,7-/m0/s1 |
| InChIKey | GGUOTLSRCHTGKF-XVMARJQXSA-N |
| XLogP | -0.10 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |