C16H22O5 — CID 66677124
(8S,8aR)-2,2-dimethyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 66677124) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is (8S,8aR)-2,2-dimethyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (8S,8aR)-2,2-dimethyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 66677124 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (8S,8aR)-2,2-dimethyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | CC1(C)OCC2OCC(O)[C@H](OCc3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C16H22O5/c1-16(2)20-10-13-15(21-16)14(12(17)9-18-13)19-8-11-6-4-3-5-7-11/h3-7,12-15,17H,8-10H2,1-2H3/t12?,13?,14-,15+/m0/s1 |
| InChIKey | RMUXJCYTECEGKM-PFSRBDOWSA-N |
| XLogP | 1.48 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |