C23H28O5 — CID 146032402
(4R,5S,6S,7aS)-2,2-dimethyl-4,6-bis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-ol (PubChem CID 146032402) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is (4R,5S,6S,7aS)-2,2-dimethyl-4,6-bis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-ol.
| Compound Name | (4R,5S,6S,7aS)-2,2-dimethyl-4,6-bis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 146032402 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | (4R,5S,6S,7aS)-2,2-dimethyl-4,6-bis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-ol |
| SMILES | CC1(C)OC2[C@H](C[C@H](OCc3ccccc3)[C@H](O)[C@H]2OCc2ccccc2)O1 |
| InChI | InChI=1S/C23H28O5/c1-23(2)27-19-13-18(25-14-16-9-5-3-6-10-16)20(24)22(21(19)28-23)26-15-17-11-7-4-8-12-17/h3-12,18-22,24H,13-15H2,1-2H3/t18-,19-,20-,21?,22+/m0/s1 |
| InChIKey | ZBGITEDCKLLKDK-REGXASCXSA-N |
| XLogP | 3.44 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |