C16H19NO5 — CID 73175458
6-hydroxy-2,2-dimethyl-7-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-carbonitrile (PubChem CID 73175458) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is 6-hydroxy-2,2-dimethyl-7-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-carbonitrile.
| Compound Name | 6-hydroxy-2,2-dimethyl-7-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-carbonitrile |
|---|---|
| PubChem CID | 73175458 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 6-hydroxy-2,2-dimethyl-7-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-carbonitrile |
| SMILES | CC1(C)OC2OC(C#N)C(O)C(OCc3ccccc3)C2O1 |
| InChI | InChI=1S/C16H19NO5/c1-16(2)21-14-13(19-9-10-6-4-3-5-7-10)12(18)11(8-17)20-15(14)22-16/h3-7,11-15,18H,9H2,1-2H3 |
| InChIKey | BYDOLPOXMWRHBW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 80.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |