C23H28O5 — CID 59491267
(3aS,6S,7aS)-2,2,5-trimethyl-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran (PubChem CID 59491267) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is (3aS,6S,7aS)-2,2,5-trimethyl-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran.
| Compound Name | (3aS,6S,7aS)-2,2,5-trimethyl-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran |
|---|---|
| PubChem CID | 59491267 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | (3aS,6S,7aS)-2,2,5-trimethyl-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran |
| SMILES | CC1O[C@H]2OC(C)(C)O[C@H]2C(OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H28O5/c1-16-19(24-14-17-10-6-4-7-11-17)20(25-15-18-12-8-5-9-13-18)21-22(26-16)28-23(2,3)27-21/h4-13,16,19-22H,14-15H2,1-3H3/t16?,19-,20?,21-,22-/m0/s1 |
| InChIKey | MLUPBGQCHIAHHR-KFUSDTRHSA-N |
| XLogP | 4.05 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |