C24H24O4 — CID 154713978
(5S)-2,2-dimethyl-5-naphthalen-2-yl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 154713978) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is (5S)-2,2-dimethyl-5-naphthalen-2-yl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (5S)-2,2-dimethyl-5-naphthalen-2-yl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 154713978 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (5S)-2,2-dimethyl-5-naphthalen-2-yl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CC1(C)OC2O[C@@H](c3ccc4ccccc4c3)C(OCc3ccccc3)C2O1 |
| InChI | InChI=1S/C24H24O4/c1-24(2)27-22-21(25-15-16-8-4-3-5-9-16)20(26-23(22)28-24)19-13-12-17-10-6-7-11-18(17)14-19/h3-14,20-23H,15H2,1-2H3/t20-,21?,22?,23?/m0/s1 |
| InChIKey | OTBZZDPJURYCKJ-LEISRSHCSA-N |
| XLogP | 4.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |