C16H22O5 — CID 123659975
2,2,5-trimethyl-7-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-ol (PubChem CID 123659975) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2,2,5-trimethyl-7-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-ol.
| Compound Name | 2,2,5-trimethyl-7-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-ol |
|---|---|
| PubChem CID | 123659975 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2,2,5-trimethyl-7-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-ol |
| SMILES | CC1OC2OC(C)(C)OC2C(OCc2ccccc2)C1O |
| InChI | InChI=1S/C16H22O5/c1-10-12(17)13(18-9-11-7-5-4-6-8-11)14-15(19-10)21-16(2,3)20-14/h4-8,10,12-15,17H,9H2,1-3H3 |
| InChIKey | VYZDSLJWWMIHFB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |