C14H20O4 — CID 167585367
(2S,3S,5S)-2,6-dimethyl-4-phenylmethoxyoxane-3,5-diol (PubChem CID 167585367) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (2S,3S,5S)-2,6-dimethyl-4-phenylmethoxyoxane-3,5-diol.
| Compound Name | (2S,3S,5S)-2,6-dimethyl-4-phenylmethoxyoxane-3,5-diol |
|---|---|
| PubChem CID | 167585367 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (2S,3S,5S)-2,6-dimethyl-4-phenylmethoxyoxane-3,5-diol |
| SMILES | CC1O[C@@H](C)[C@H](O)C(OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C14H20O4/c1-9-12(15)14(13(16)10(2)18-9)17-8-11-6-4-3-5-7-11/h3-7,9-10,12-16H,8H2,1-2H3/t9-,10?,12-,13-,14?/m0/s1 |
| InChIKey | ABWCJQMNVDHMLZ-IJTQNZPMSA-N |
| XLogP | 1.10 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |