C12H16O6 — CID 131023997
(2S,3S,5R,6R)-4-phenylmethoxyoxane-2,3,5,6-tetrol (PubChem CID 131023997) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is (2S,3S,5R,6R)-4-phenylmethoxyoxane-2,3,5,6-tetrol.
| Compound Name | (2S,3S,5R,6R)-4-phenylmethoxyoxane-2,3,5,6-tetrol |
|---|---|
| PubChem CID | 131023997 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (2S,3S,5R,6R)-4-phenylmethoxyoxane-2,3,5,6-tetrol |
| SMILES | O[C@@H]1O[C@H](O)[C@@H](O)C(OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C12H16O6/c13-8-10(9(14)12(16)18-11(8)15)17-6-7-4-2-1-3-5-7/h1-5,8-16H,6H2/t8-,9+,10?,11-,12+ |
| InChIKey | RMBJHMHDHKCFNW-PQENDOFNSA-N |
| XLogP | -1.04 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |